戇戇居士

Integral dx/√(9-x²)=?

Measuring Gases help?

Prove that (n-2)(n-1)(2n-3) is divisible by 6 for any positive integer greater than 2. Where did I go wrong?

Math help. Calculus. Question is in the Picture?

2.20 g of solid NaOH are added to 250 mL of a 0.10 M FeCl2 solution. Given that Ksp for Fe(OH)2 is 1.6 × 10-14, calculate the following?

Find the length of the line segment joining each pair of points.(Show as exact solution) a) M(3,7) and A(1,3) b) B(5,-1) and C(-3,4)?

what is the maximum mass of CFCl2 that can be made from 10g of hydrogen fluoride?

1.) 12a^3 - 9a + 4a -3 2.) 3n^3 - 4n^2 + 9n-12?

The element nickel (Ni) has a density of 8.91 g/cm3. How many moles of nickel are there in 5.0 L of nickel. (molar mass 58.69 g/mol)?

what is 15ft by 25ft in squared metres?

Show that the equation tan(30◦ + θ) = 2 tan(60◦ − θ) can be written in the form tan2 θ + (6 √3)tan θ − 5 = 0.?

can velocity change if acceleration is zero? Please explain?

please work out the turning point of the curve and the max and min points of f(x)=x2-3x+2?

Please help solve for V1/V2 for 3=20log_10(V2/V1)?

acid and base reactions?

What is the conjugate acid of HF?

why are tertiary alkyl halides practically inert to substitution by SN2 mechanism?

Molecules are closer together in solids than liquids. So why does frozen water expand?

Need to solve 9p-3(8-p) with method if anyone can please!?

Please help me with physics?

Intro to Chem?

Chemistry help please?

CHEMISTRY HELP PLEEEEASE?

plz help me : b - 7b =?

The area A of a shape is related to the length x of one side by the quadratic equation:?

Please find attached image below thanks in advance?

PLEASE SOMEONE HELP WiTH THIS CHEM QUESTION!!? 10 points?

Need help... Thanks!?

A ball is thrown horizontally from top of a sky-rise building 144 ft high with a velocity of 20 ft/sec. Neglecting air resistance, find d?

N2(g) + 3H2(g) → 2NH3(g) ΔH=-46.1 KJ/mole which one is true about the equilibrium(Keq) constant for the given reaction.?

When the following equation is balanced in an acidic solution how many moles of water are present?

Chemistry question need help. Concentration problem. Thank you in advance :)?

WHAT IS THE NAME OF THIS COMPOUND:CH3CH(CH3)CH2CH2OH?

total number of lone pairs in C2H2Cl2O?

Is anyone good at chemistry?

The volume of a rectangular box is 192 cubic centimeters. What is the height of the box if the area of the base is 48 square centimeters?

Math help?

In this question the methyl group CH3 is described as Me.Trimethylamine Me3N reacts with boron triflouride BF3 to form compound of Me3NBF3?

Math question! Let θ be an angle in quadrant IV such that cosθ = 3/5. Find the exact values of cscθ and cotθ.?

How many mL of 0.750 M solution of lithium phosphate solution must be used to deliver 10.3 g of lithium?

A sample of nitrogen occupies 10.0 liters at 25°C and 98.7 kPa. What would be the volume at 20°C and 102.7 kPa?

chemical equation of propane , C3H8+5O2 -->3CO2+4H2O How many grams of O2(g) are needed to completely burn 62.0 g of C3H8(g)?

what is the partial pressure of gas D in kPa (kilopascals)?

pH Calculations?

why does CH3OH have a higher boiling point than F2 and CH3F?

Gas has a volume of 135mL at 0.600atm. What would be the volume if the pressure is decreased to 0.200atm while temperature is held constant?

Consider the following reaction: 3NO2(g) + H2O(l) → HN....?

What is the pH of solution?

what is the relative molecular mass of methylated spirits?

What is the pressure of the gas in this mercury manometer if h = 57 mm and atmospheric pressure is 769 mmHg?